C21H22FNOS — CID 143948110
[3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylsulfanylphenyl)methanone (PubChem CID 143948110) has the molecular formula C21H22FNOS and a molecular weight of 355.48 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylsulfanylphenyl)methanone.
| Compound Name | [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 143948110 |
| Molecular Formula | C21H22FNOS |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | [3-(4-fluorophenyl)-8-azabicyclo[3.2.1]octan-8-yl]-(3-methylsulfanylphenyl)methanone |
| SMILES | CSc1cccc(C(=O)N2C3CCC2CC(c2ccc(F)cc2)C3)c1 |
| InChI | InChI=1S/C21H22FNOS/c1-25-20-4-2-3-15(13-20)21(24)23-18-9-10-19(23)12-16(11-18)14-5-7-17(22)8-6-14/h2-8,13,16,18-19H,9-12H2,1H3 |
| InChIKey | SSAZBMQVQAKHOR-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |