C19H24N4O — CID 110137434
[(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 110137434) has the molecular formula C19H24N4O and a molecular weight of 324.43 g/mol. Its IUPAC name is [(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 110137434 |
| Molecular Formula | C19H24N4O |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [(2S,3aR,8aS)-2-phenyl-3,3a,4,5,6,7,8,8a-octahydro-2H-pyrrolo[3,2-b]azepin-1-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)N2[C@H](c3ccccc3)C[C@H]3NCCCC[C@@H]32)cn1 |
| InChI | InChI=1S/C19H24N4O/c1-22-13-15(12-21-22)19(24)23-17-9-5-6-10-20-16(17)11-18(23)14-7-3-2-4-8-14/h2-4,7-8,12-13,16-18,20H,5-6,9-11H2,1H3/t16-,17+,18+/m1/s1 |
| InChIKey | WXLQYYDZXFYWRX-SQNIBIBYSA-N |
| XLogP | 2.52 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |