C20H19N5O — CID 110196732
(1-methylpyrazol-4-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone (PubChem CID 110196732) has the molecular formula C20H19N5O and a molecular weight of 345.41 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone.
| Compound Name | (1-methylpyrazol-4-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
|---|---|
| PubChem CID | 110196732 |
| Molecular Formula | C20H19N5O |
| Molecular Weight | 345.41 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | (1-methylpyrazol-4-yl)-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]methanone |
| SMILES | Cn1cc(C(=O)N2[C@H]3CC[C@@H]2c2cnc(-c4ccccc4)nc2C3)cn1 |
| InChI | InChI=1S/C20H19N5O/c1-24-12-14(10-22-24)20(26)25-15-7-8-18(25)16-11-21-19(23-17(16)9-15)13-5-3-2-4-6-13/h2-6,10-12,15,18H,7-9H2,1H3/t15-,18+/m0/s1 |
| InChIKey | MBCJEHJUOZCOIG-MAUKXSAKSA-N |
| XLogP | 2.78 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |