C23H22N4O — CID 156610004
N-(3-methylphenyl)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 156610004) has the molecular formula C23H22N4O and a molecular weight of 370.46 g/mol. Its IUPAC name is N-(3-methylphenyl)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | N-(3-methylphenyl)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 156610004 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-(3-methylphenyl)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | Cc1cccc(NC(=O)N2C3CCC2c2cnc(-c4ccccc4)nc2C3)c1 |
| InChI | InChI=1S/C23H22N4O/c1-15-6-5-9-17(12-15)25-23(28)27-18-10-11-21(27)19-14-24-22(26-20(19)13-18)16-7-3-2-4-8-16/h2-9,12,14,18,21H,10-11,13H2,1H3,(H,25,28) |
| InChIKey | MMSSICLWXNEOHL-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |