C24H21FN4O3 — CID 156609997
methyl 4-[[5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]benzoate (PubChem CID 156609997) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is methyl 4-[[5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 156609997 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | methyl 4-[[5-(4-fluorophenyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)N2C3CCC2c2cnc(-c4ccc(F)cc4)nc2C3)cc1 |
| InChI | InChI=1S/C24H21FN4O3/c1-32-23(30)15-4-8-17(9-5-15)27-24(31)29-18-10-11-21(29)19-13-26-22(28-20(19)12-18)14-2-6-16(25)7-3-14/h2-9,13,18,21H,10-12H2,1H3,(H,27,31) |
| InChIKey | GBUMBMQJFRFVPL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |