C20H17FN4OS — CID 168862408
(1R,9S)-6-fluoro-N-[4-(1,3-thiazol-4-yl)phenyl]-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 168862408) has the molecular formula C20H17FN4OS and a molecular weight of 380.45 g/mol. Its IUPAC name is (1R,9S)-6-fluoro-N-[4-(1,3-thiazol-4-yl)phenyl]-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1R,9S)-6-fluoro-N-[4-(1,3-thiazol-4-yl)phenyl]-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862408 |
| Molecular Formula | C20H17FN4OS |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (1R,9S)-6-fluoro-N-[4-(1,3-thiazol-4-yl)phenyl]-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(-c2cscn2)cc1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C20H17FN4OS/c21-19-16-9-14-5-6-18(15(16)7-8-22-19)25(14)20(26)24-13-3-1-12(2-4-13)17-10-27-11-23-17/h1-4,7-8,10-11,14,18H,5-6,9H2,(H,24,26)/t14-,18+/m0/s1 |
| InChIKey | YSZBKDYOMUYFMM-KBXCAEBGSA-N |
| XLogP | 4.64 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|