C14H14FN5OS — CID 164548771
(1S,9R)-6-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 164548771) has the molecular formula C14H14FN5OS and a molecular weight of 319.37 g/mol. Its IUPAC name is (1S,9R)-6-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R)-6-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 164548771 |
| Molecular Formula | C14H14FN5OS |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | (1S,9R)-6-fluoro-N-(5-methyl-1,3,4-thiadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | Cc1nnc(NC(=O)N2[C@@H]3CC[C@H]2c2ccnc(F)c2C3)s1 |
| InChI | InChI=1S/C14H14FN5OS/c1-7-18-19-13(22-7)17-14(21)20-8-2-3-11(20)9-4-5-16-12(15)10(9)6-8/h4-5,8,11H,2-3,6H2,1H3,(H,17,19,21)/t8-,11+/m1/s1 |
| InChIKey | ZSAXXMRYFIVGKD-KCJUWKMLSA-N |
| XLogP | 2.67 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|