C19H16FN5O2 — CID 164548765
6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 164548765) has the molecular formula C19H16FN5O2 and a molecular weight of 365.37 g/mol. Its IUPAC name is 6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | 6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 164548765 |
| Molecular Formula | C19H16FN5O2 |
| Molecular Weight | 365.37 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | 6-fluoro-N-(5-phenyl-1,3,4-oxadiazol-2-yl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)o1)N1C2CCC1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C19H16FN5O2/c20-16-14-10-12-6-7-15(13(14)8-9-21-16)25(12)19(26)22-18-24-23-17(27-18)11-4-2-1-3-5-11/h1-5,8-9,12,15H,6-7,10H2,(H,22,24,26) |
| InChIKey | RGQMNXMVIFKQLF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|