C18H13BrF5N3O — CID 168862523
(1S,9R)-N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 168862523) has the molecular formula C18H13BrF5N3O and a molecular weight of 462.22 g/mol. Its IUPAC name is (1S,9R)-N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R)-N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862523 |
| Molecular Formula | C18H13BrF5N3O |
| Molecular Weight | 462.22 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | (1S,9R)-N-[5-bromo-2-fluoro-4-(trifluoromethyl)phenyl]-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(Nc1cc(Br)c(C(F)(F)F)cc1F)N1[C@@H]2CC[C@H]1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C18H13BrF5N3O/c19-12-7-14(13(20)6-11(12)18(22,23)24)26-17(28)27-8-1-2-15(27)9-3-4-25-16(21)10(9)5-8/h3-4,6-8,15H,1-2,5H2,(H,26,28)/t8-,15+/m1/s1 |
| InChIKey | IJEANDCPKDVWLN-GLEZIHRCSA-N |
| XLogP | 5.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.22 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|