C22H19FN4O2 — CID 164548639
(1R,9S)-6-fluoro-N-(6-phenoxy-3-pyridinyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 164548639) has the molecular formula C22H19FN4O2 and a molecular weight of 390.42 g/mol. Its IUPAC name is (1R,9S)-6-fluoro-N-(6-phenoxy-3-pyridinyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1R,9S)-6-fluoro-N-(6-phenoxy-3-pyridinyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 164548639 |
| Molecular Formula | C22H19FN4O2 |
| Molecular Weight | 390.42 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1R,9S)-6-fluoro-N-(6-phenoxy-3-pyridinyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(Oc2ccccc2)nc1)N1[C@H]2CC[C@@H]1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C22H19FN4O2/c23-21-18-12-15-7-8-19(17(18)10-11-24-21)27(15)22(28)26-14-6-9-20(25-13-14)29-16-4-2-1-3-5-16/h1-6,9-11,13,15,19H,7-8,12H2,(H,26,28)/t15-,19+/m0/s1 |
| InChIKey | AWEUGLSKVVNNSP-HNAYVOBHSA-N |
| XLogP | 4.70 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.42 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|