C17H14Cl3N3O — CID 168862643
(1S,9R)-6-chloro-N-(3,4-dichlorophenyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 168862643) has the molecular formula C17H14Cl3N3O and a molecular weight of 382.68 g/mol. Its IUPAC name is (1S,9R)-6-chloro-N-(3,4-dichlorophenyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1S,9R)-6-chloro-N-(3,4-dichlorophenyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862643 |
| Molecular Formula | C17H14Cl3N3O |
| Molecular Weight | 382.68 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | (1S,9R)-6-chloro-N-(3,4-dichlorophenyl)-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1[C@@H]2CC[C@H]1c1ccnc(Cl)c1C2 |
| InChI | InChI=1S/C17H14Cl3N3O/c18-13-3-1-9(7-14(13)19)22-17(24)23-10-2-4-15(23)11-5-6-21-16(20)12(11)8-10/h1,3,5-7,10,15H,2,4,8H2,(H,22,24)/t10-,15+/m1/s1 |
| InChIKey | ZWFBYVPCHRFTII-BMIGLBTASA-N |
| XLogP | 5.34 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|