C18H15Cl3N2O — CID 175889160
(1R,9S)-5-chloro-N-(3,4-dichlorophenyl)-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 175889160) has the molecular formula C18H15Cl3N2O and a molecular weight of 381.69 g/mol. Its IUPAC name is (1R,9S)-5-chloro-N-(3,4-dichlorophenyl)-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | (1R,9S)-5-chloro-N-(3,4-dichlorophenyl)-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 175889160 |
| Molecular Formula | C18H15Cl3N2O |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (1R,9S)-5-chloro-N-(3,4-dichlorophenyl)-12-azatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1[C@H]2CC[C@@H]1c1ccc(Cl)cc1C2 |
| InChI | InChI=1S/C18H15Cl3N2O/c19-11-1-4-14-10(7-11)8-13-3-6-17(14)23(13)18(24)22-12-2-5-15(20)16(21)9-12/h1-2,4-5,7,9,13,17H,3,6,8H2,(H,22,24)/t13-,17+/m0/s1 |
| InChIKey | XJNXNHWKKQJJHY-SUMWQHHRSA-N |
| XLogP | 5.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |