C22H24Cl2N4O3 — CID 175889194
tert-butyl-[(1R,9S)-12-[(3,4-dichlorophenyl)carbamoyl]-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-yl]carbamic acid (PubChem CID 175889194) has the molecular formula C22H24Cl2N4O3 and a molecular weight of 463.37 g/mol. Its IUPAC name is tert-butyl-[(1R,9S)-12-[(3,4-dichlorophenyl)carbamoyl]-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-yl]carbamic acid.
| Compound Name | tert-butyl-[(1R,9S)-12-[(3,4-dichlorophenyl)carbamoyl]-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-yl]carbamic acid |
|---|---|
| PubChem CID | 175889194 |
| Molecular Formula | C22H24Cl2N4O3 |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | tert-butyl-[(1R,9S)-12-[(3,4-dichlorophenyl)carbamoyl]-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-trien-3-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)c1nccc2c1[C@H]1CC[C@@H](C2)N1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C22H24Cl2N4O3/c1-22(2,3)28(21(30)31)19-18-12(8-9-25-19)10-14-5-7-17(18)27(14)20(29)26-13-4-6-15(23)16(24)11-13/h4,6,8-9,11,14,17H,5,7,10H2,1-3H3,(H,26,29)(H,30,31)/t14-,17+/m0/s1 |
| InChIKey | OJJFKYQPTMDRPR-WMLDXEAASA-N |
| XLogP | 5.97 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |