C17H14BrCl2N3O — CID 168862534
5-bromo-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 168862534) has the molecular formula C17H14BrCl2N3O and a molecular weight of 427.13 g/mol. Its IUPAC name is 5-bromo-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | 5-bromo-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862534 |
| Molecular Formula | C17H14BrCl2N3O |
| Molecular Weight | 427.13 g/mol |
| Exact Mass | 424.97 |
| IUPAC Name | 5-bromo-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1C2CCC1c1cnc(Br)cc1C2 |
| InChI | InChI=1S/C17H14BrCl2N3O/c18-16-6-9-5-11-2-4-15(12(9)8-21-16)23(11)17(24)22-10-1-3-13(19)14(20)7-10/h1,3,6-8,11,15H,2,4-5H2,(H,22,24) |
| InChIKey | FQIJMLLIWLTKJH-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.13 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|