C21H24Cl2N4O — CID 168862601
3-(tert-butylamino)-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 168862601) has the molecular formula C21H24Cl2N4O and a molecular weight of 419.36 g/mol. Its IUPAC name is 3-(tert-butylamino)-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | 3-(tert-butylamino)-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862601 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-(tert-butylamino)-N-(3,4-dichlorophenyl)-4,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | CC(C)(C)Nc1nccc2c1C1CCC(C2)N1C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H24Cl2N4O/c1-21(2,3)26-19-18-12(8-9-24-19)10-14-5-7-17(18)27(14)20(28)25-13-4-6-15(22)16(23)11-13/h4,6,8-9,11,14,17H,5,7,10H2,1-3H3,(H,24,26)(H,25,28) |
| InChIKey | LVKATHNEDRSQAZ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |