C17H14ClF3N4O — CID 168862401
(1R,9S)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3,5,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 168862401) has the molecular formula C17H14ClF3N4O and a molecular weight of 382.77 g/mol. Its IUPAC name is (1R,9S)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3,5,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | (1R,9S)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3,5,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862401 |
| Molecular Formula | C17H14ClF3N4O |
| Molecular Weight | 382.77 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (1R,9S)-N-[3-chloro-4-(trifluoromethyl)phenyl]-3,5,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)c(Cl)c1)N1[C@H]2CC[C@@H]1c1ncncc1C2 |
| InChI | InChI=1S/C17H14ClF3N4O/c18-13-6-10(1-3-12(13)17(19,20)21)24-16(26)25-11-2-4-14(25)15-9(5-11)7-22-8-23-15/h1,3,6-8,11,14H,2,4-5H2,(H,24,26)/t11-,14+/m0/s1 |
| InChIKey | SKWIMFXPDRYLME-SMDDNHRTSA-N |
| XLogP | 4.44 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.77 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |