C17H14Cl2FN3O — CID 168862600
N-(3,4-dichlorophenyl)-6-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 168862600) has the molecular formula C17H14Cl2FN3O and a molecular weight of 366.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-6-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-6-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862600 |
| Molecular Formula | C17H14Cl2FN3O |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-(3,4-dichlorophenyl)-6-fluoro-4,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1C2CCC1c1cncc(F)c1C2 |
| InChI | InChI=1S/C17H14Cl2FN3O/c18-13-3-1-9(5-14(13)19)22-17(24)23-10-2-4-16(23)12-7-21-8-15(20)11(12)6-10/h1,3,5,7-8,10,16H,2,4,6H2,(H,22,24) |
| InChIKey | VDUHJPKOUNRDDJ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |