C17H13Cl2F3N4O — CID 168862450
N-(3,4-dichlorophenyl)-5-(trifluoromethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide (PubChem CID 168862450) has the molecular formula C17H13Cl2F3N4O and a molecular weight of 417.22 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-5-(trifluoromethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide.
| Compound Name | N-(3,4-dichlorophenyl)-5-(trifluoromethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862450 |
| Molecular Formula | C17H13Cl2F3N4O |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-5-(trifluoromethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-12-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(Cl)c1)N1C2CCC1c1cnc(C(F)(F)F)nc1C2 |
| InChI | InChI=1S/C17H13Cl2F3N4O/c18-11-3-1-8(5-12(11)19)24-16(27)26-9-2-4-14(26)10-7-23-15(17(20,21)22)25-13(10)6-9/h1,3,5,7,9,14H,2,4,6H2,(H,24,27) |
| InChIKey | HQPQQOJHYPIJJT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |