C18H14ClFN4O — CID 168862443
N-(4-chloro-3-cyanophenyl)-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide (PubChem CID 168862443) has the molecular formula C18H14ClFN4O and a molecular weight of 356.79 g/mol. Its IUPAC name is N-(4-chloro-3-cyanophenyl)-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide.
| Compound Name | N-(4-chloro-3-cyanophenyl)-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
|---|---|
| PubChem CID | 168862443 |
| Molecular Formula | C18H14ClFN4O |
| Molecular Weight | 356.79 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N-(4-chloro-3-cyanophenyl)-6-fluoro-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboxamide |
| SMILES | N#Cc1cc(NC(=O)N2C3CCC2c2ccnc(F)c2C3)ccc1Cl |
| InChI | InChI=1S/C18H14ClFN4O/c19-15-3-1-11(7-10(15)9-21)23-18(25)24-12-2-4-16(24)13-5-6-22-17(20)14(13)8-12/h1,3,5-7,12,16H,2,4,8H2,(H,23,25) |
| InChIKey | DZJKBIFLRCUTDU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.79 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|