C18H16Cl2F2N4O — CID 166098801
N'-(4,5-dichloro-2-fluorophenyl)-6-fluoro-N-methoxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide (PubChem CID 166098801) has the molecular formula C18H16Cl2F2N4O and a molecular weight of 413.26 g/mol. Its IUPAC name is N'-(4,5-dichloro-2-fluorophenyl)-6-fluoro-N-methoxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide.
| Compound Name | N'-(4,5-dichloro-2-fluorophenyl)-6-fluoro-N-methoxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide |
|---|---|
| PubChem CID | 166098801 |
| Molecular Formula | C18H16Cl2F2N4O |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N'-(4,5-dichloro-2-fluorophenyl)-6-fluoro-N-methoxy-5,12-diazatricyclo[7.2.1.02,7]dodeca-2(7),3,5-triene-12-carboximidamide |
| SMILES | CON/C(=N\c1cc(Cl)c(Cl)cc1F)N1C2CCC1c1ccnc(F)c1C2 |
| InChI | InChI=1S/C18H16Cl2F2N4O/c1-27-25-18(24-15-8-13(20)12(19)7-14(15)21)26-9-2-3-16(26)10-4-5-23-17(22)11(10)6-9/h4-5,7-9,16H,2-3,6H2,1H3,(H,24,25) |
| InChIKey | ZPUJFGBWDRRHOA-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 49.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|