C24H23N3O2 — CID 110196710
2-(3-methylphenoxy)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone (PubChem CID 110196710) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 2-(3-methylphenoxy)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone.
| Compound Name | 2-(3-methylphenoxy)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
|---|---|
| PubChem CID | 110196710 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 2-(3-methylphenoxy)-1-[(1R,9S)-5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl]ethanone |
| SMILES | Cc1cccc(OCC(=O)N2[C@H]3CC[C@@H]2c2cnc(-c4ccccc4)nc2C3)c1 |
| InChI | InChI=1S/C24H23N3O2/c1-16-6-5-9-19(12-16)29-15-23(28)27-18-10-11-22(27)20-14-25-24(26-21(20)13-18)17-7-3-2-4-8-17/h2-9,12,14,18,22H,10-11,13,15H2,1H3/t18-,22+/m0/s1 |
| InChIKey | AQPWPCQTBPJOGA-PGRDOPGGSA-N |
| XLogP | 4.12 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |