C24H23N3O — CID 156610145
(2,4-dimethylphenyl)-(5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methanone (PubChem CID 156610145) has the molecular formula C24H23N3O and a molecular weight of 369.47 g/mol. Its IUPAC name is (2,4-dimethylphenyl)-(5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methanone.
| Compound Name | (2,4-dimethylphenyl)-(5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methanone |
|---|---|
| PubChem CID | 156610145 |
| Molecular Formula | C24H23N3O |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | (2,4-dimethylphenyl)-(5-phenyl-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-12-yl)methanone |
| SMILES | Cc1ccc(C(=O)N2C3CCC2c2cnc(-c4ccccc4)nc2C3)c(C)c1 |
| InChI | InChI=1S/C24H23N3O/c1-15-8-10-19(16(2)12-15)24(28)27-18-9-11-22(27)20-14-25-23(26-21(20)13-18)17-6-4-3-5-7-17/h3-8,10,12,14,18,22H,9,11,13H2,1-2H3 |
| InChIKey | VBQQHTJPWPPYRO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |