C19H20N6O — CID 163336171
(1-methylpyrazol-4-yl)-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone (PubChem CID 163336171) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is (1-methylpyrazol-4-yl)-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone.
| Compound Name | (1-methylpyrazol-4-yl)-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone |
|---|---|
| PubChem CID | 163336171 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (1-methylpyrazol-4-yl)-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone |
| SMILES | Cn1cc(C(=O)N2[C@@H]3CC[C@H]2Cc2nnc(-c4ccccc4)n2C3)cn1 |
| InChI | InChI=1S/C19H20N6O/c1-23-11-14(10-20-23)19(26)25-15-7-8-16(25)12-24-17(9-15)21-22-18(24)13-5-3-2-4-6-13/h2-6,10-11,15-16H,7-9,12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | DHYIBBQSKGIFDM-JKSUJKDBSA-N |
| XLogP | 1.91 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |