C20H24N4O2 — CID 163336169
oxan-4-yl-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone (PubChem CID 163336169) has the molecular formula C20H24N4O2 and a molecular weight of 352.44 g/mol. Its IUPAC name is oxan-4-yl-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone.
| Compound Name | oxan-4-yl-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone |
|---|---|
| PubChem CID | 163336169 |
| Molecular Formula | C20H24N4O2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | oxan-4-yl-[(1R,9S)-4-phenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]methanone |
| SMILES | O=C(C1CCOCC1)N1[C@@H]2CC[C@H]1Cc1nnc(-c3ccccc3)n1C2 |
| InChI | InChI=1S/C20H24N4O2/c25-20(15-8-10-26-11-9-15)24-16-6-7-17(24)13-23-18(12-16)21-22-19(23)14-4-2-1-3-5-14/h1-5,15-17H,6-13H2/t16-,17+/m0/s1 |
| InChIKey | ZPPGMIIUBLGAJU-DLBZAZTESA-N |
| XLogP | 2.29 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |