C21H21N5O — CID 163336149
(1R,9S)-N,4-diphenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene-12-carboxamide (PubChem CID 163336149) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is (1R,9S)-N,4-diphenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene-12-carboxamide.
| Compound Name | (1R,9S)-N,4-diphenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene-12-carboxamide |
|---|---|
| PubChem CID | 163336149 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (1R,9S)-N,4-diphenyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene-12-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1[C@@H]2CC[C@H]1Cc1nnc(-c3ccccc3)n1C2 |
| InChI | InChI=1S/C21H21N5O/c27-21(22-16-9-5-2-6-10-16)26-17-11-12-18(26)14-25-19(13-17)23-24-20(25)15-7-3-1-4-8-15/h1-10,17-18H,11-14H2,(H,22,27)/t17-,18+/m0/s1 |
| InChIKey | VVPPWMRWBWCXGI-ZWKOTPCHSA-N |
| XLogP | 3.57 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |