C19H19N5O — CID 121150130
N-phenyl-3-(4-phenyltriazol-1-yl)pyrrolidine-1-carboxamide (PubChem CID 121150130) has the molecular formula C19H19N5O and a molecular weight of 333.39 g/mol. Its IUPAC name is N-phenyl-3-(4-phenyltriazol-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | N-phenyl-3-(4-phenyltriazol-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 121150130 |
| Molecular Formula | C19H19N5O |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | N-phenyl-3-(4-phenyltriazol-1-yl)pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCC(n2cc(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C19H19N5O/c25-19(20-16-9-5-2-6-10-16)23-12-11-17(13-23)24-14-18(21-22-24)15-7-3-1-4-8-15/h1-10,14,17H,11-13H2,(H,20,25) |
| InChIKey | DHUSMXHSFDPIIG-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |