C21H22N4OS — CID 99986511
2-benzylsulfanyl-1-[(3R)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone (PubChem CID 99986511) has the molecular formula C21H22N4OS and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-benzylsulfanyl-1-[(3R)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-benzylsulfanyl-1-[(3R)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99986511 |
| Molecular Formula | C21H22N4OS |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2-benzylsulfanyl-1-[(3R)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CSCc1ccccc1)N1CC[C@@H](n2cc(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C21H22N4OS/c26-21(16-27-15-17-7-3-1-4-8-17)24-12-11-19(13-24)25-14-20(22-23-25)18-9-5-2-6-10-18/h1-10,14,19H,11-13,15-16H2/t19-/m1/s1 |
| InChIKey | XCJMEQNMVZAAKK-LJQANCHMSA-N |
| XLogP | 3.65 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |