C22H24N4OS — CID 99986656
3-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]propan-1-one (PubChem CID 99986656) has the molecular formula C22H24N4OS and a molecular weight of 392.53 g/mol. Its IUPAC name is 3-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]propan-1-one.
| Compound Name | 3-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 99986656 |
| Molecular Formula | C22H24N4OS |
| Molecular Weight | 392.53 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-(4-methylsulfanylphenyl)-1-[(3S)-3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]propan-1-one |
| SMILES | CSc1ccc(CCC(=O)N2CC[C@H](n3cc(-c4ccccc4)nn3)C2)cc1 |
| InChI | InChI=1S/C22H24N4OS/c1-28-20-10-7-17(8-11-20)9-12-22(27)25-14-13-19(15-25)26-16-21(23-24-26)18-5-3-2-4-6-18/h2-8,10-11,16,19H,9,12-15H2,1H3/t19-/m0/s1 |
| InChIKey | PFZUGGPQHGLXDV-IBGZPJMESA-N |
| XLogP | 4.07 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.53 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |