C24H30N4O — CID 121150012
2-(1-adamantyl)-1-[3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone (PubChem CID 121150012) has the molecular formula C24H30N4O and a molecular weight of 390.53 g/mol. Its IUPAC name is 2-(1-adamantyl)-1-[3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(1-adamantyl)-1-[3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 121150012 |
| Molecular Formula | C24H30N4O |
| Molecular Weight | 390.53 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 2-(1-adamantyl)-1-[3-(4-phenyltriazol-1-yl)pyrrolidin-1-yl]ethanone |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)N1CCC(n2cc(-c3ccccc3)nn2)C1 |
| InChI | InChI=1S/C24H30N4O/c29-23(14-24-11-17-8-18(12-24)10-19(9-17)13-24)27-7-6-21(15-27)28-16-22(25-26-28)20-4-2-1-3-5-20/h1-5,16-19,21H,6-15H2 |
| InChIKey | ZVLLXLQLNQOSHJ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |