C22H23N5O — CID 163337193
2-(2-methylphenyl)-1-[(1R,9S)-4-pyridin-3-yl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone (PubChem CID 163337193) has the molecular formula C22H23N5O and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-(2-methylphenyl)-1-[(1R,9S)-4-pyridin-3-yl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone.
| Compound Name | 2-(2-methylphenyl)-1-[(1R,9S)-4-pyridin-3-yl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone |
|---|---|
| PubChem CID | 163337193 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(2-methylphenyl)-1-[(1R,9S)-4-pyridin-3-yl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]ethanone |
| SMILES | Cc1ccccc1CC(=O)N1[C@@H]2CC[C@H]1Cc1nnc(-c3cccnc3)n1C2 |
| InChI | InChI=1S/C22H23N5O/c1-15-5-2-3-6-16(15)11-21(28)27-18-8-9-19(27)14-26-20(12-18)24-25-22(26)17-7-4-10-23-13-17/h2-7,10,13,18-19H,8-9,11-12,14H2,1H3/t18-,19+/m0/s1 |
| InChIKey | MVBIIUGXXXDPNR-RBUKOAKNSA-N |
| XLogP | 2.81 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |