C15H18N4OS — CID 163336378
1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-3-ylethanone (PubChem CID 163336378) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 163336378 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-[(1R,9S)-4-methyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-3-ylethanone |
| SMILES | Cc1nnc2n1C[C@H]1CC[C@@H](C2)N1C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C15H18N4OS/c1-10-16-17-14-7-12-2-3-13(8-18(10)14)19(12)15(20)6-11-4-5-21-9-11/h4-5,9,12-13H,2-3,6-8H2,1H3/t12-,13+/m0/s1 |
| InChIKey | UMRPPSFUEGPHBF-QWHCGFSZSA-N |
| XLogP | 1.81 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |