C13H16N2O2S — CID 133139082
(1R,6S)-9-(2-thiophen-3-ylacetyl)-3,9-diazabicyclo[4.2.1]nonan-4-one (PubChem CID 133139082) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is (1R,6S)-9-(2-thiophen-3-ylacetyl)-3,9-diazabicyclo[4.2.1]nonan-4-one.
| Compound Name | (1R,6S)-9-(2-thiophen-3-ylacetyl)-3,9-diazabicyclo[4.2.1]nonan-4-one |
|---|---|
| PubChem CID | 133139082 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | (1R,6S)-9-(2-thiophen-3-ylacetyl)-3,9-diazabicyclo[4.2.1]nonan-4-one |
| SMILES | O=C1C[C@@H]2CC[C@H](CN1)N2C(=O)Cc1ccsc1 |
| InChI | InChI=1S/C13H16N2O2S/c16-12-6-10-1-2-11(7-14-12)15(10)13(17)5-9-3-4-18-8-9/h3-4,8,10-11H,1-2,5-7H2,(H,14,16)/t10-,11+/m0/s1 |
| InChIKey | XFWJENBTNOPDCZ-WDEREUQCSA-N |
| XLogP | 1.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |