C16H20N4OS — CID 163336089
1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-2-ylethanone (PubChem CID 163336089) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-2-ylethanone.
| Compound Name | 1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 163336089 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-thiophen-2-ylethanone |
| SMILES | CCc1nnc2n1C[C@H]1CC[C@@H](C2)N1C(=O)Cc1cccs1 |
| InChI | InChI=1S/C16H20N4OS/c1-2-14-17-18-15-8-11-5-6-12(10-19(14)15)20(11)16(21)9-13-4-3-7-22-13/h3-4,7,11-12H,2,5-6,8-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | LBHNWHCNZQCAKK-NWDGAFQWSA-N |
| XLogP | 2.06 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |