C17H22N4O3S — CID 163337030
(1R,9S)-4-ethyl-12-(3-methoxyphenyl)sulfonyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene (PubChem CID 163337030) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is (1R,9S)-4-ethyl-12-(3-methoxyphenyl)sulfonyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene.
| Compound Name | (1R,9S)-4-ethyl-12-(3-methoxyphenyl)sulfonyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
|---|---|
| PubChem CID | 163337030 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (1R,9S)-4-ethyl-12-(3-methoxyphenyl)sulfonyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
| SMILES | CCc1nnc2n1C[C@H]1CC[C@@H](C2)N1S(=O)(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C17H22N4O3S/c1-3-16-18-19-17-9-12-7-8-13(11-20(16)17)21(12)25(22,23)15-6-4-5-14(10-15)24-2/h4-6,10,12-13H,3,7-9,11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | OKMNCSVDNXWMNL-QWHCGFSZSA-N |
| XLogP | 1.63 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |