C13H17N5O3S — CID 91909491
1-(3-methoxyphenyl)sulfonyl-3-(2H-tetrazol-5-yl)piperidine (PubChem CID 91909491) has the molecular formula C13H17N5O3S and a molecular weight of 323.38 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)sulfonyl-3-(2H-tetrazol-5-yl)piperidine.
| Compound Name | 1-(3-methoxyphenyl)sulfonyl-3-(2H-tetrazol-5-yl)piperidine |
|---|---|
| PubChem CID | 91909491 |
| Molecular Formula | C13H17N5O3S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 1-(3-methoxyphenyl)sulfonyl-3-(2H-tetrazol-5-yl)piperidine |
| SMILES | COc1cccc(S(=O)(=O)N2CCCC(c3nn[nH]n3)C2)c1 |
| InChI | InChI=1S/C13H17N5O3S/c1-21-11-5-2-6-12(8-11)22(19,20)18-7-3-4-10(9-18)13-14-16-17-15-13/h2,5-6,8,10H,3-4,7,9H2,1H3,(H,14,15,16,17) |
| InChIKey | MPDHDUHZBIWTAW-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |