C18H22N4O2 — CID 163337565
1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-phenoxyethanone (PubChem CID 163337565) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is 1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-phenoxyethanone.
| Compound Name | 1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 163337565 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 1-[(1R,9S)-4-ethyl-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-dien-12-yl]-2-phenoxyethanone |
| SMILES | CCc1nnc2n1C[C@H]1CC[C@@H](C2)N1C(=O)COc1ccccc1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-16-19-20-17-10-13-8-9-14(11-21(16)17)22(13)18(23)12-24-15-6-4-3-5-7-15/h3-7,13-14H,2,8-12H2,1H3/t13-,14+/m0/s1 |
| InChIKey | WVQIFVBARDZNPH-UONOGXRCSA-N |
| XLogP | 1.84 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |