C16H20FN5 — CID 163337399
(1R,9S)-4-ethyl-12-[(3-fluoro-4-pyridinyl)methyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene (PubChem CID 163337399) has the molecular formula C16H20FN5 and a molecular weight of 301.37 g/mol. Its IUPAC name is (1R,9S)-4-ethyl-12-[(3-fluoro-4-pyridinyl)methyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene.
| Compound Name | (1R,9S)-4-ethyl-12-[(3-fluoro-4-pyridinyl)methyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
|---|---|
| PubChem CID | 163337399 |
| Molecular Formula | C16H20FN5 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | (1R,9S)-4-ethyl-12-[(3-fluoro-4-pyridinyl)methyl]-3,5,6,12-tetrazatricyclo[7.2.1.03,7]dodeca-4,6-diene |
| SMILES | CCc1nnc2n1C[C@H]1CC[C@@H](C2)N1Cc1ccncc1F |
| InChI | InChI=1S/C16H20FN5/c1-2-15-19-20-16-7-12-3-4-13(10-22(15)16)21(12)9-11-5-6-18-8-14(11)17/h5-6,8,12-13H,2-4,7,9-10H2,1H3/t12-,13+/m0/s1 |
| InChIKey | MBTONDHWMJTCJC-QWHCGFSZSA-N |
| XLogP | 1.96 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |