C17H26N6 — CID 650800
1-[(1-tert-butyltetrazol-5-yl)-pyridin-4-ylmethyl]azepane (PubChem CID 650800) has the molecular formula C17H26N6 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-pyridin-4-ylmethyl]azepane.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-pyridin-4-ylmethyl]azepane |
|---|---|
| PubChem CID | 650800 |
| Molecular Formula | C17H26N6 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-pyridin-4-ylmethyl]azepane |
| SMILES | CC(C)(C)n1nnnc1C(c1ccncc1)N1CCCCCC1 |
| InChI | InChI=1S/C17H26N6/c1-17(2,3)23-16(19-20-21-23)15(14-8-10-18-11-9-14)22-12-6-4-5-7-13-22/h8-11,15H,4-7,12-13H2,1-3H3 |
| InChIKey | QTKSZRFHSFUIHK-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |