C21H33N7 — CID 644767
1-[(1-tert-butyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-cyclohexylpiperazine (PubChem CID 644767) has the molecular formula C21H33N7 and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-cyclohexylpiperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-cyclohexylpiperazine |
|---|---|
| PubChem CID | 644767 |
| Molecular Formula | C21H33N7 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.28 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)-pyridin-3-ylmethyl]-4-cyclohexylpiperazine |
| SMILES | CC(C)(C)n1nnnc1C(c1cccnc1)N1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C21H33N7/c1-21(2,3)28-20(23-24-25-28)19(17-8-7-11-22-16-17)27-14-12-26(13-15-27)18-9-5-4-6-10-18/h7-8,11,16,18-19H,4-6,9-10,12-15H2,1-3H3 |
| InChIKey | DYPHMVSEMUELLT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |