C24H30ClN7 — CID 647675
1-(5-chloro-2-methylphenyl)-4-[(1-cyclohexyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine (PubChem CID 647675) has the molecular formula C24H30ClN7 and a molecular weight of 452.01 g/mol. Its IUPAC name is 1-(5-chloro-2-methylphenyl)-4-[(1-cyclohexyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine.
| Compound Name | 1-(5-chloro-2-methylphenyl)-4-[(1-cyclohexyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine |
|---|---|
| PubChem CID | 647675 |
| Molecular Formula | C24H30ClN7 |
| Molecular Weight | 452.01 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-(5-chloro-2-methylphenyl)-4-[(1-cyclohexyltetrazol-5-yl)-pyridin-3-ylmethyl]piperazine |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(c2cccnc2)c2nnnn2C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H30ClN7/c1-18-9-10-20(25)16-22(18)30-12-14-31(15-13-30)23(19-6-5-11-26-17-19)24-27-28-29-32(24)21-7-3-2-4-8-21/h5-6,9-11,16-17,21,23H,2-4,7-8,12-15H2,1H3 |
| InChIKey | XJYRYUOGCGZHDF-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 62.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.01 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |