C27H30N4O2 — CID 171144940
12-(3,4-dimethylbenzoyl)-N,N-dimethyl-4-phenyl-3,5,12-triazatricyclo[7.2.1.03,7]dodeca-4,6-diene-6-carboxamide (PubChem CID 171144940) has the molecular formula C27H30N4O2 and a molecular weight of 442.56 g/mol. Its IUPAC name is 12-(3,4-dimethylbenzoyl)-N,N-dimethyl-4-phenyl-3,5,12-triazatricyclo[7.2.1.03,7]dodeca-4,6-diene-6-carboxamide.
| Compound Name | 12-(3,4-dimethylbenzoyl)-N,N-dimethyl-4-phenyl-3,5,12-triazatricyclo[7.2.1.03,7]dodeca-4,6-diene-6-carboxamide |
|---|---|
| PubChem CID | 171144940 |
| Molecular Formula | C27H30N4O2 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.24 |
| IUPAC Name | 12-(3,4-dimethylbenzoyl)-N,N-dimethyl-4-phenyl-3,5,12-triazatricyclo[7.2.1.03,7]dodeca-4,6-diene-6-carboxamide |
| SMILES | Cc1ccc(C(=O)N2C3CCC2Cn2c(-c4ccccc4)nc(C(=O)N(C)C)c2C3)cc1C |
| InChI | InChI=1S/C27H30N4O2/c1-17-10-11-20(14-18(17)2)26(32)31-21-12-13-22(31)16-30-23(15-21)24(27(33)29(3)4)28-25(30)19-8-6-5-7-9-19/h5-11,14,21-22H,12-13,15-16H2,1-4H3 |
| InChIKey | XGLYVSLRXKFJDF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 58.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |