C22H28N4O — CID 110137684
[(2R,3aS,8aR)-4-methyl-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-1-yl]-(2,4-dimethylpyrimidin-5-yl)methanone (PubChem CID 110137684) has the molecular formula C22H28N4O and a molecular weight of 364.49 g/mol. Its IUPAC name is [(2R,3aS,8aR)-4-methyl-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-1-yl]-(2,4-dimethylpyrimidin-5-yl)methanone.
| Compound Name | [(2R,3aS,8aR)-4-methyl-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-1-yl]-(2,4-dimethylpyrimidin-5-yl)methanone |
|---|---|
| PubChem CID | 110137684 |
| Molecular Formula | C22H28N4O |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | [(2R,3aS,8aR)-4-methyl-2-phenyl-2,3,3a,5,6,7,8,8a-octahydropyrrolo[3,2-b]azepin-1-yl]-(2,4-dimethylpyrimidin-5-yl)methanone |
| SMILES | Cc1ncc(C(=O)N2[C@@H](c3ccccc3)C[C@H]3[C@H]2CCCCN3C)c(C)n1 |
| InChI | InChI=1S/C22H28N4O/c1-15-18(14-23-16(2)24-15)22(27)26-19-11-7-8-12-25(3)21(19)13-20(26)17-9-5-4-6-10-17/h4-6,9-10,14,19-21H,7-8,11-13H2,1-3H3/t19-,20-,21+/m1/s1 |
| InChIKey | BYMKVPXKZCYOON-NJYVYQBISA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |