C21H28ClNO3 — CID 21153815
benzoic acid;3-(2-phenylpiperidin-1-yl)propan-1-ol;hydrochloride (PubChem CID 21153815) has the molecular formula C21H28ClNO3 and a molecular weight of 377.91 g/mol. Its IUPAC name is benzoic acid;3-(2-phenylpiperidin-1-yl)propan-1-ol;hydrochloride.
| Compound Name | benzoic acid;3-(2-phenylpiperidin-1-yl)propan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 21153815 |
| Molecular Formula | C21H28ClNO3 |
| Molecular Weight | 377.91 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | benzoic acid;3-(2-phenylpiperidin-1-yl)propan-1-ol;hydrochloride |
| SMILES | Cl.O=C(O)c1ccccc1.OCCCN1CCCCC1c1ccccc1 |
| InChI | InChI=1S/C14H21NO.C7H6O2.ClH/c16-12-6-11-15-10-5-4-9-14(15)13-7-2-1-3-8-13;8-7(9)6-4-2-1-3-5-6;/h1-3,7-8,14,16H,4-6,9-12H2;1-5H,(H,8,9);1H |
| InChIKey | YEZCSALVWAWQMX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.91 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |