C14H21NO3 — CID 113390704
5-cyclopentyl-3-pentan-3-yl-1,2-oxazole-4-carboxylic acid (PubChem CID 113390704) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-cyclopentyl-3-pentan-3-yl-1,2-oxazole-4-carboxylic acid.
| Compound Name | 5-cyclopentyl-3-pentan-3-yl-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 113390704 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 5-cyclopentyl-3-pentan-3-yl-1,2-oxazole-4-carboxylic acid |
| SMILES | CCC(CC)c1noc(C2CCCC2)c1C(=O)O |
| InChI | InChI=1S/C14H21NO3/c1-3-9(4-2)12-11(14(16)17)13(18-15-12)10-7-5-6-8-10/h9-10H,3-8H2,1-2H3,(H,16,17) |
| InChIKey | KVHHCYUFFLQLOQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |