C11H18N2O — CID 105448363
(5-cyclohexyl-4-methyl-1,3-oxazol-2-yl)methanamine (PubChem CID 105448363) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (5-cyclohexyl-4-methyl-1,3-oxazol-2-yl)methanamine.
| Compound Name | (5-cyclohexyl-4-methyl-1,3-oxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 105448363 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (5-cyclohexyl-4-methyl-1,3-oxazol-2-yl)methanamine |
| SMILES | Cc1nc(CN)oc1C1CCCCC1 |
| InChI | InChI=1S/C11H18N2O/c1-8-11(14-10(7-12)13-8)9-5-3-2-4-6-9/h9H,2-7,12H2,1H3 |
| InChIKey | FBSSNZAYQNDOKT-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |