C13H22N2O — CID 105479719
(4-cyclohexyl-5-propan-2-yl-1,3-oxazol-2-yl)methanamine (PubChem CID 105479719) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is (4-cyclohexyl-5-propan-2-yl-1,3-oxazol-2-yl)methanamine.
| Compound Name | (4-cyclohexyl-5-propan-2-yl-1,3-oxazol-2-yl)methanamine |
|---|---|
| PubChem CID | 105479719 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | (4-cyclohexyl-5-propan-2-yl-1,3-oxazol-2-yl)methanamine |
| SMILES | CC(C)c1oc(CN)nc1C1CCCCC1 |
| InChI | InChI=1S/C13H22N2O/c1-9(2)13-12(15-11(8-14)16-13)10-6-4-3-5-7-10/h9-10H,3-8,14H2,1-2H3 |
| InChIKey | NKUJLEZSUSUGNC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |