C9H15N3O — CID 82408362
(4-cyclohexyl-1,2,5-oxadiazol-3-yl)methanamine (PubChem CID 82408362) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is (4-cyclohexyl-1,2,5-oxadiazol-3-yl)methanamine.
| Compound Name | (4-cyclohexyl-1,2,5-oxadiazol-3-yl)methanamine |
|---|---|
| PubChem CID | 82408362 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | (4-cyclohexyl-1,2,5-oxadiazol-3-yl)methanamine |
| SMILES | NCc1nonc1C1CCCCC1 |
| InChI | InChI=1S/C9H15N3O/c10-6-8-9(12-13-11-8)7-4-2-1-3-5-7/h7H,1-6,10H2 |
| InChIKey | QAHSRFUBSCTCKU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |