C15H24N2O — CID 101405411
3,4-dicyclohexyl-1,2-oxazol-5-amine (PubChem CID 101405411) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is 3,4-dicyclohexyl-1,2-oxazol-5-amine.
| Compound Name | 3,4-dicyclohexyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 101405411 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 3,4-dicyclohexyl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(C2CCCCC2)c1C1CCCCC1 |
| InChI | InChI=1S/C15H24N2O/c16-15-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h11-12H,1-10,16H2 |
| InChIKey | LOUMHYXNBUVIQP-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |