C14H14Cl2N2O — CID 43335969
3-cyclopentyl-4-(2,4-dichlorophenyl)-1,2-oxazol-5-amine (PubChem CID 43335969) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is 3-cyclopentyl-4-(2,4-dichlorophenyl)-1,2-oxazol-5-amine.
| Compound Name | 3-cyclopentyl-4-(2,4-dichlorophenyl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43335969 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | 3-cyclopentyl-4-(2,4-dichlorophenyl)-1,2-oxazol-5-amine |
| SMILES | Nc1onc(C2CCCC2)c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O/c15-9-5-6-10(11(16)7-9)12-13(18-19-14(12)17)8-3-1-2-4-8/h5-8H,1-4,17H2 |
| InChIKey | JQBBARVQJYNYMV-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |