C15H18N2O — CID 43158023
3-cyclohexyl-4-phenyl-1,2-oxazol-5-amine (PubChem CID 43158023) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 3-cyclohexyl-4-phenyl-1,2-oxazol-5-amine.
| Compound Name | 3-cyclohexyl-4-phenyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 43158023 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 3-cyclohexyl-4-phenyl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(C2CCCCC2)c1-c1ccccc1 |
| InChI | InChI=1S/C15H18N2O/c16-15-13(11-7-3-1-4-8-11)14(17-18-15)12-9-5-2-6-10-12/h1,3-4,7-8,12H,2,5-6,9-10,16H2 |
| InChIKey | IYNNGFAMMHJSSQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |